C14H8F2N2O5 — CID 57286081
(4-nitrophenyl) N-(2,6-difluorobenzoyl)carbamate (PubChem CID 57286081) has the molecular formula C14H8F2N2O5 and a molecular weight of 322.22 g/mol. Its IUPAC name is (4-nitrophenyl) N-(2,6-difluorobenzoyl)carbamate.
| Compound Name | (4-nitrophenyl) N-(2,6-difluorobenzoyl)carbamate |
|---|---|
| PubChem CID | 57286081 |
| Molecular Formula | C14H8F2N2O5 |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | (4-nitrophenyl) N-(2,6-difluorobenzoyl)carbamate |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H8F2N2O5/c15-10-2-1-3-11(16)12(10)13(19)17-14(20)23-9-6-4-8(5-7-9)18(21)22/h1-7H,(H,17,19,20) |
| InChIKey | DNXWOLXAZWJJSM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|