C27H24ClFN4O7 — CID 166027308
(4-nitrophenyl) (3S,5R)-3-[(4-chloro-3-fluorophenyl)carbamoyl]-5-(phenylmethoxycarbonylamino)piperidine-1-carboxylate (PubChem CID 166027308) has the molecular formula C27H24ClFN4O7 and a molecular weight of 570.96 g/mol. Its IUPAC name is (4-nitrophenyl) (3S,5R)-3-[(4-chloro-3-fluorophenyl)carbamoyl]-5-(phenylmethoxycarbonylamino)piperidine-1-carboxylate.
| Compound Name | (4-nitrophenyl) (3S,5R)-3-[(4-chloro-3-fluorophenyl)carbamoyl]-5-(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166027308 |
| Molecular Formula | C27H24ClFN4O7 |
| Molecular Weight | 570.96 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | (4-nitrophenyl) (3S,5R)-3-[(4-chloro-3-fluorophenyl)carbamoyl]-5-(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
| SMILES | O=C(N[C@@H]1C[C@H](C(=O)Nc2ccc(Cl)c(F)c2)CN(C(=O)Oc2ccc([N+](=O)[O-])cc2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C27H24ClFN4O7/c28-23-11-6-19(13-24(23)29)30-25(34)18-12-20(31-26(35)39-16-17-4-2-1-3-5-17)15-32(14-18)27(36)40-22-9-7-21(8-10-22)33(37)38/h1-11,13,18,20H,12,14-16H2,(H,30,34)(H,31,35)/t18-,20+/m0/s1 |
| InChIKey | YRPLVPKOAOPICM-AZUAARDMSA-N |
| XLogP | 5.14 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.96 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|