C24H22F4N4O6 — CID 141402674
(4-nitrophenyl) 3-(3-ethoxy-1H-pyrazol-5-yl)-5-[3-fluoro-4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate (PubChem CID 141402674) has the molecular formula C24H22F4N4O6 and a molecular weight of 538.45 g/mol. Its IUPAC name is (4-nitrophenyl) 3-(3-ethoxy-1H-pyrazol-5-yl)-5-[3-fluoro-4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate.
| Compound Name | (4-nitrophenyl) 3-(3-ethoxy-1H-pyrazol-5-yl)-5-[3-fluoro-4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 141402674 |
| Molecular Formula | C24H22F4N4O6 |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | (4-nitrophenyl) 3-(3-ethoxy-1H-pyrazol-5-yl)-5-[3-fluoro-4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate |
| SMILES | CCOc1cc(C2CC(c3ccc(OC(F)(F)F)c(F)c3)CN(C(=O)Oc3ccc([N+](=O)[O-])cc3)C2)[nH]n1 |
| InChI | InChI=1S/C24H22F4N4O6/c1-2-36-22-11-20(29-30-22)16-9-15(14-3-8-21(19(25)10-14)38-24(26,27)28)12-31(13-16)23(33)37-18-6-4-17(5-7-18)32(34)35/h3-8,10-11,15-16H,2,9,12-13H2,1H3,(H,29,30) |
| InChIKey | VQLSLHYBECUMIW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|