C17H14Cl2O2 — CID 90920712
2,3-dichloro-1,5-diphenylpentane-1,4-dione (PubChem CID 90920712) has the molecular formula C17H14Cl2O2 and a molecular weight of 321.20 g/mol. Its IUPAC name is 2,3-dichloro-1,5-diphenylpentane-1,4-dione.
| Compound Name | 2,3-dichloro-1,5-diphenylpentane-1,4-dione |
|---|---|
| PubChem CID | 90920712 |
| Molecular Formula | C17H14Cl2O2 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2,3-dichloro-1,5-diphenylpentane-1,4-dione |
| SMILES | O=C(Cc1ccccc1)C(Cl)C(Cl)C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H14Cl2O2/c18-15(14(20)11-12-7-3-1-4-8-12)16(19)17(21)13-9-5-2-6-10-13/h1-10,15-16H,11H2 |
| InChIKey | YSTRJNPQYAUVAA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|