About methyl acetate;4-methyl-1-[[(1S,2S)-2-methyl-4-piperidin-1-ylcyclopentyl]methyl]piperidine
methyl acetate;4-methyl-1-[[(1S,2S)-2-methyl-4-piperidin-1-ylcyclopentyl]methyl]piperidine (PubChem CID 90921020) has the molecular formula C21H40N2O2
and a molecular weight of 352.56 g/mol. Its IUPAC name is methyl acetate;4-methyl-1-[[(1S,2S)-2-methyl-4-piperidin-1-ylcyclopentyl]methyl]piperidine.
Molecular Properties
| Compound Name | methyl acetate;4-methyl-1-[[(1S,2S)-2-methyl-4-piperidin-1-ylcyclopentyl]methyl]piperidine |
| PubChem CID | 90921020 |
| Molecular Formula | C21H40N2O2 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | methyl acetate;4-methyl-1-[[(1S,2S)-2-methyl-4-piperidin-1-ylcyclopentyl]methyl]piperidine |
| SMILES | CC1CCN(C[C@H]2CC(N3CCCCC3)C[C@@H]2C)CC1.COC(C)=O |
| InChI | InChI=1S/C18H34N2.C3H6O2/c1-15-6-10-19(11-7-15)14-17-13-18(12-16(17)2)20-8-4-3-5-9-20;1-3(4)5-2/h15-18H,3-14H2,1-2H3;1-2H3/t16-,17+,18?;/m0./s1 |
| InChIKey | XBBSSROTPXLBFM-NMVUSRFUSA-N |
| XLogP | 3.80 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl acetate;4-methyl-1-[[(1S,2S)-2-methyl-4-piperidin-1-ylcyclopentyl]methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl acetate;4-methyl-1-[[(1S,2S)-2-methyl-4-piperidin-1-ylcyclopentyl]methyl]piperidine?
The IUPAC name of methyl acetate;4-methyl-1-[[(1S,2S)-2-methyl-4-piperidin-1-ylcyclopentyl]methyl]piperidine (CID 90921020) is methyl acetate;4-methyl-1-[[(1S,2S)-2-methyl-4-piperidin-1-ylcyclopentyl]methyl]piperidine.
What is the SMILES notation for methyl acetate;4-methyl-1-[[(1S,2S)-2-methyl-4-piperidin-1-ylcyclopentyl]methyl]piperidine?
The canonical SMILES for methyl acetate;4-methyl-1-[[(1S,2S)-2-methyl-4-piperidin-1-ylcyclopentyl]methyl]piperidine is CC1CCN(C[C@H]2CC(N3CCCCC3)C[C@@H]2C)CC1.COC(C)=O.
What is the InChIKey of methyl acetate;4-methyl-1-[[(1S,2S)-2-methyl-4-piperidin-1-ylcyclopentyl]methyl]piperidine?
The InChIKey is XBBSSROTPXLBFM-NMVUSRFUSA-N. The full InChI is InChI=1S/C18H34N2.C3H6O2/c1-15-6-10-19(11-7-15)14-17-13-18(12-16(17)2)20-8-4-3-5-9-20;1-3(4)5-2/h15-18H,3-14H2,1-2H3;1-2H3/t16-,17+,18?;/m0./s1.
What are the key properties of methyl acetate;4-methyl-1-[[(1S,2S)-2-methyl-4-piperidin-1-ylcyclopentyl]methyl]piperidine?
methyl acetate;4-methyl-1-[[(1S,2S)-2-methyl-4-piperidin-1-ylcyclopentyl]methyl]piperidine has a molecular weight of 352.56 g/mol, XLogP of 3.80, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl acetate;4-methyl-1-[[(1S,2S)-2-methyl-4-piperidin-1-ylcyclopentyl]methyl]piperidine is sourced from PubChem (CID 90921020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).