C37H34N2O3 — CID 90924050
N-[(2S,3R)-3-hydroxy-4-[[(1S)-1-naphthalen-2-ylethyl]amino]-1-phenylbutan-2-yl]benzo[b][1]benzoxepine-5-carboxamide (PubChem CID 90924050) has the molecular formula C37H34N2O3 and a molecular weight of 554.69 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-4-[[(1S)-1-naphthalen-2-ylethyl]amino]-1-phenylbutan-2-yl]benzo[b][1]benzoxepine-5-carboxamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-4-[[(1S)-1-naphthalen-2-ylethyl]amino]-1-phenylbutan-2-yl]benzo[b][1]benzoxepine-5-carboxamide |
|---|---|
| PubChem CID | 90924050 |
| Molecular Formula | C37H34N2O3 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-4-[[(1S)-1-naphthalen-2-ylethyl]amino]-1-phenylbutan-2-yl]benzo[b][1]benzoxepine-5-carboxamide |
| SMILES | C[C@H](NC[C@@H](O)[C@H](Cc1ccccc1)NC(=O)C1=Cc2ccccc2Oc2ccccc21)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C37H34N2O3/c1-25(28-20-19-27-13-5-6-14-29(27)22-28)38-24-34(40)33(21-26-11-3-2-4-12-26)39-37(41)32-23-30-15-7-9-17-35(30)42-36-18-10-8-16-31(32)36/h2-20,22-23,25,33-34,38,40H,21,24H2,1H3,(H,39,41)/t25-,33-,34+/m0/s1 |
| InChIKey | HTMQQTLHDRMKOI-ZCWDHQIGSA-N |
| XLogP | 6.93 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|