C38H34N2O3 — CID 91499749
N-[(2S,3S)-3-hydroxy-1-phenyl-4-[(3-phenylphenyl)methylamino]butan-2-yl]benzo[b][1]benzoxepine-5-carboxamide (PubChem CID 91499749) has the molecular formula C38H34N2O3 and a molecular weight of 566.70 g/mol. Its IUPAC name is N-[(2S,3S)-3-hydroxy-1-phenyl-4-[(3-phenylphenyl)methylamino]butan-2-yl]benzo[b][1]benzoxepine-5-carboxamide.
| Compound Name | N-[(2S,3S)-3-hydroxy-1-phenyl-4-[(3-phenylphenyl)methylamino]butan-2-yl]benzo[b][1]benzoxepine-5-carboxamide |
|---|---|
| PubChem CID | 91499749 |
| Molecular Formula | C38H34N2O3 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | N-[(2S,3S)-3-hydroxy-1-phenyl-4-[(3-phenylphenyl)methylamino]butan-2-yl]benzo[b][1]benzoxepine-5-carboxamide |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@@H](O)CNCc1cccc(-c2ccccc2)c1)C1=Cc2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C38H34N2O3/c41-35(26-39-25-28-14-11-18-30(22-28)29-15-5-2-6-16-29)34(23-27-12-3-1-4-13-27)40-38(42)33-24-31-17-7-9-20-36(31)43-37-21-10-8-19-32(33)37/h1-22,24,34-35,39,41H,23,25-26H2,(H,40,42)/t34-,35-/m0/s1 |
| InChIKey | YEPQEOCVVQVHPP-PXLJZGITSA-N |
| XLogP | 6.88 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|