C18H26ClN3O3 — CID 90924220
tert-butyl 5-[3-(4-chloro-1H-pyrrol-2-yl)-3-oxopropanimidoyl]-2-methylpiperidine-1-carboxylate (PubChem CID 90924220) has the molecular formula C18H26ClN3O3 and a molecular weight of 367.88 g/mol. Its IUPAC name is tert-butyl 5-[3-(4-chloro-1H-pyrrol-2-yl)-3-oxopropanimidoyl]-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 5-[3-(4-chloro-1H-pyrrol-2-yl)-3-oxopropanimidoyl]-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 90924220 |
| Molecular Formula | C18H26ClN3O3 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | tert-butyl 5-[3-(4-chloro-1H-pyrrol-2-yl)-3-oxopropanimidoyl]-2-methylpiperidine-1-carboxylate |
| SMILES | [H]/N=C(\CC(=O)c1cc(Cl)c[nH]1)C1CCC(C)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H26ClN3O3/c1-11-5-6-12(10-22(11)17(24)25-18(2,3)4)14(20)8-16(23)15-7-13(19)9-21-15/h7,9,11-12,20-21H,5-6,8,10H2,1-4H3/b20-14+ |
| InChIKey | UMCBCOWXOSTIFJ-XSFVSMFZSA-N |
| XLogP | 4.30 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|