C16H20N4 — CID 90924542
1-(3,4,4a,5,6,8a-hexahydro-1,7-naphthyridin-4-yl)-5,8-dihydro-4H-1,7-naphthyridine (PubChem CID 90924542) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,8a-hexahydro-1,7-naphthyridin-4-yl)-5,8-dihydro-4H-1,7-naphthyridine.
| Compound Name | 1-(3,4,4a,5,6,8a-hexahydro-1,7-naphthyridin-4-yl)-5,8-dihydro-4H-1,7-naphthyridine |
|---|---|
| PubChem CID | 90924542 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 1-(3,4,4a,5,6,8a-hexahydro-1,7-naphthyridin-4-yl)-5,8-dihydro-4H-1,7-naphthyridine |
| SMILES | C1=CN(C2CC=NC3C=NCCC32)C2=C(C1)CC=NC2 |
| InChI | InChI=1S/C16H20N4/c1-2-12-3-6-18-11-16(12)20(9-1)15-5-8-19-14-10-17-7-4-13(14)15/h1,6,8-10,13-15H,2-5,7,11H2 |
| InChIKey | CODQMDNUNKSWNC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |