C27H26N2O4 — CID 90928405
2-hydroxy-4-methoxy-1-(3-phenoxyphenyl)-N-(2-propan-2-ylphenyl)pyrrole-3-carboxamide (PubChem CID 90928405) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-hydroxy-4-methoxy-1-(3-phenoxyphenyl)-N-(2-propan-2-ylphenyl)pyrrole-3-carboxamide.
| Compound Name | 2-hydroxy-4-methoxy-1-(3-phenoxyphenyl)-N-(2-propan-2-ylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 90928405 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 2-hydroxy-4-methoxy-1-(3-phenoxyphenyl)-N-(2-propan-2-ylphenyl)pyrrole-3-carboxamide |
| SMILES | COc1cn(-c2cccc(Oc3ccccc3)c2)c(O)c1C(=O)Nc1ccccc1C(C)C |
| InChI | InChI=1S/C27H26N2O4/c1-18(2)22-14-7-8-15-23(22)28-26(30)25-24(32-3)17-29(27(25)31)19-10-9-13-21(16-19)33-20-11-5-4-6-12-20/h4-18,31H,1-3H3,(H,28,30) |
| InChIKey | QUHAQEWTWCGJIY-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |