C23H22FN3O3 — CID 90928713
[6-[3-(2-fluorophenoxy)pyrrolidin-1-yl]-3-pyridinyl] N-benzylcarbamate (PubChem CID 90928713) has the molecular formula C23H22FN3O3 and a molecular weight of 407.45 g/mol. Its IUPAC name is [6-[3-(2-fluorophenoxy)pyrrolidin-1-yl]-3-pyridinyl] N-benzylcarbamate.
| Compound Name | [6-[3-(2-fluorophenoxy)pyrrolidin-1-yl]-3-pyridinyl] N-benzylcarbamate |
|---|---|
| PubChem CID | 90928713 |
| Molecular Formula | C23H22FN3O3 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | [6-[3-(2-fluorophenoxy)pyrrolidin-1-yl]-3-pyridinyl] N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)Oc1ccc(N2CCC(Oc3ccccc3F)C2)nc1 |
| InChI | InChI=1S/C23H22FN3O3/c24-20-8-4-5-9-21(20)29-19-12-13-27(16-19)22-11-10-18(15-25-22)30-23(28)26-14-17-6-2-1-3-7-17/h1-11,15,19H,12-14,16H2,(H,26,28) |
| InChIKey | IWSVLGRKTRKFKM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |