C23H19FN2O2 — CID 68807009
3-[2-[6-[3-(2-fluorophenoxy)pyrrolidin-1-yl]-3-pyridinyl]ethynyl]phenol (PubChem CID 68807009) has the molecular formula C23H19FN2O2 and a molecular weight of 374.42 g/mol. Its IUPAC name is 3-[2-[6-[3-(2-fluorophenoxy)pyrrolidin-1-yl]-3-pyridinyl]ethynyl]phenol.
| Compound Name | 3-[2-[6-[3-(2-fluorophenoxy)pyrrolidin-1-yl]-3-pyridinyl]ethynyl]phenol |
|---|---|
| PubChem CID | 68807009 |
| Molecular Formula | C23H19FN2O2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-[2-[6-[3-(2-fluorophenoxy)pyrrolidin-1-yl]-3-pyridinyl]ethynyl]phenol |
| SMILES | Oc1cccc(C#Cc2ccc(N3CCC(Oc4ccccc4F)C3)nc2)c1 |
| InChI | InChI=1S/C23H19FN2O2/c24-21-6-1-2-7-22(21)28-20-12-13-26(16-20)23-11-10-18(15-25-23)9-8-17-4-3-5-19(27)14-17/h1-7,10-11,14-15,20,27H,12-13,16H2 |
| InChIKey | WSBPFRVTGRDGMQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|