C25H21F2N3O3 — CID 90975594
2-[2-fluoro-4-[2-[6-[4-(2-fluorophenoxy)piperidin-1-yl]pyridazin-3-yl]ethynyl]phenyl]acetic acid (PubChem CID 90975594) has the molecular formula C25H21F2N3O3 and a molecular weight of 449.46 g/mol. Its IUPAC name is 2-[2-fluoro-4-[2-[6-[4-(2-fluorophenoxy)piperidin-1-yl]pyridazin-3-yl]ethynyl]phenyl]acetic acid.
| Compound Name | 2-[2-fluoro-4-[2-[6-[4-(2-fluorophenoxy)piperidin-1-yl]pyridazin-3-yl]ethynyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 90975594 |
| Molecular Formula | C25H21F2N3O3 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 2-[2-fluoro-4-[2-[6-[4-(2-fluorophenoxy)piperidin-1-yl]pyridazin-3-yl]ethynyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(C#Cc2ccc(N3CCC(Oc4ccccc4F)CC3)nn2)cc1F |
| InChI | InChI=1S/C25H21F2N3O3/c26-21-3-1-2-4-23(21)33-20-11-13-30(14-12-20)24-10-9-19(28-29-24)8-6-17-5-7-18(16-25(31)32)22(27)15-17/h1-5,7,9-10,15,20H,11-14,16H2,(H,31,32) |
| InChIKey | LJPRBHSUVKJXQE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|