C25H23FN4O2 — CID 25025747
[4-[2-[6-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pyridazin-3-yl]ethynyl]phenyl] acetate (PubChem CID 25025747) has the molecular formula C25H23FN4O2 and a molecular weight of 430.48 g/mol. Its IUPAC name is [4-[2-[6-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pyridazin-3-yl]ethynyl]phenyl] acetate.
| Compound Name | [4-[2-[6-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pyridazin-3-yl]ethynyl]phenyl] acetate |
|---|---|
| PubChem CID | 25025747 |
| Molecular Formula | C25H23FN4O2 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | [4-[2-[6-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pyridazin-3-yl]ethynyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C#Cc2ccc(N3CCN(Cc4ccccc4F)CC3)nn2)cc1 |
| InChI | InChI=1S/C25H23FN4O2/c1-19(31)32-23-11-7-20(8-12-23)6-9-22-10-13-25(28-27-22)30-16-14-29(15-17-30)18-21-4-2-3-5-24(21)26/h2-5,7-8,10-13H,14-18H2,1H3 |
| InChIKey | SMAQNOAGMORZGJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|