C20H18F2N2O2 — CID 90930092
6-(difluoromethoxy)-2-(1-propan-2-ylindol-5-yl)isoindol-1-ol (PubChem CID 90930092) has the molecular formula C20H18F2N2O2 and a molecular weight of 356.37 g/mol. Its IUPAC name is 6-(difluoromethoxy)-2-(1-propan-2-ylindol-5-yl)isoindol-1-ol.
| Compound Name | 6-(difluoromethoxy)-2-(1-propan-2-ylindol-5-yl)isoindol-1-ol |
|---|---|
| PubChem CID | 90930092 |
| Molecular Formula | C20H18F2N2O2 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 6-(difluoromethoxy)-2-(1-propan-2-ylindol-5-yl)isoindol-1-ol |
| SMILES | CC(C)n1ccc2cc(-n3cc4ccc(OC(F)F)cc4c3O)ccc21 |
| InChI | InChI=1S/C20H18F2N2O2/c1-12(2)23-8-7-13-9-15(4-6-18(13)23)24-11-14-3-5-16(26-20(21)22)10-17(14)19(24)25/h3-12,20,25H,1-2H3 |
| InChIKey | WQKTZHSUWYVSFS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 39.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |