C22H28N4O5 — CID 90930744
(2S)-2-amino-N-[4-[2-[2-(carbamoylamino)-2-oxoethyl]phenoxy]butyl]-3-(4-hydroxyphenyl)propanamide (PubChem CID 90930744) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-[2-[2-(carbamoylamino)-2-oxoethyl]phenoxy]butyl]-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2S)-2-amino-N-[4-[2-[2-(carbamoylamino)-2-oxoethyl]phenoxy]butyl]-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 90930744 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (2S)-2-amino-N-[4-[2-[2-(carbamoylamino)-2-oxoethyl]phenoxy]butyl]-3-(4-hydroxyphenyl)propanamide |
| SMILES | NC(=O)NC(=O)Cc1ccccc1OCCCCNC(=O)[C@@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C22H28N4O5/c23-18(13-15-7-9-17(27)10-8-15)21(29)25-11-3-4-12-31-19-6-2-1-5-16(19)14-20(28)26-22(24)30/h1-2,5-10,18,27H,3-4,11-14,23H2,(H,25,29)(H3,24,26,28,30)/t18-/m0/s1 |
| InChIKey | VFJHVFINEIVXGU-SFHVURJKSA-N |
| XLogP | 0.97 |
| TPSA | 156.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|