C12H15N — CID 90931785
N-ethenyl-6-methylidene-4-propan-2-ylcyclohexa-2,4-dien-1-imine (PubChem CID 90931785) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is N-ethenyl-6-methylidene-4-propan-2-ylcyclohexa-2,4-dien-1-imine.
| Compound Name | N-ethenyl-6-methylidene-4-propan-2-ylcyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 90931785 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | N-ethenyl-6-methylidene-4-propan-2-ylcyclohexa-2,4-dien-1-imine |
| SMILES | C=C/N=C1\C=CC(C(C)C)=CC1=C |
| InChI | InChI=1S/C12H15N/c1-5-13-12-7-6-11(9(2)3)8-10(12)4/h5-9H,1,4H2,2-3H3/b13-12+ |
| InChIKey | HIRQXXTVEDWIAD-OUKQBFOZSA-N |
| XLogP | 3.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|