C18H21BrO3 — CID 90933160
2-[1-(3-bromophenyl)-2-hydroxy-2-adamantyl]acetic acid (PubChem CID 90933160) has the molecular formula C18H21BrO3 and a molecular weight of 365.27 g/mol. Its IUPAC name is 2-[1-(3-bromophenyl)-2-hydroxy-2-adamantyl]acetic acid.
| Compound Name | 2-[1-(3-bromophenyl)-2-hydroxy-2-adamantyl]acetic acid |
|---|---|
| PubChem CID | 90933160 |
| Molecular Formula | C18H21BrO3 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-[1-(3-bromophenyl)-2-hydroxy-2-adamantyl]acetic acid |
| SMILES | O=C(O)CC1(O)C2CC3CC(C2)CC1(c1cccc(Br)c1)C3 |
| InChI | InChI=1S/C18H21BrO3/c19-15-3-1-2-13(7-15)17-8-11-4-12(9-17)6-14(5-11)18(17,22)10-16(20)21/h1-3,7,11-12,14,22H,4-6,8-10H2,(H,20,21) |
| InChIKey | PJYNFPVZOPOKSD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |