2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid

C19H22O4 — CID 174594523

IUPAC2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid
SMILESO=C(O)c1cccc(C(=O)O)c1CC12CC3CC(CC(C3)C1)C2
InChIInChI=1S/C19H22O4/c20-17(21)14-2-1-3-15(18(22)23)16(14)10-19-7-11-4-12(8-19)6-13(5-11)9-19/h1-3,11-13H,4-10H2,(H,20,21)(H,22,23)
InChIKeyAETNXJMNGGWZCY-UHFFFAOYSA-N
MW314.38 g/mol
LogP3.84
Rot. Bonds4

About 2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid

2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid (PubChem CID 174594523) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid
PubChem CID174594523
Molecular FormulaC19H22O4
Molecular Weight314.38 g/mol
Exact Mass314.15
IUPAC Name2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid
SMILESO=C(O)c1cccc(C(=O)O)c1CC12CC3CC(CC(C3)C1)C2
InChIInChI=1S/C19H22O4/c20-17(21)14-2-1-3-15(18(22)23)16(14)10-19-7-11-4-12(8-19)6-13(5-11)9-19/h1-3,11-13H,4-10H2,(H,20,21)(H,22,23)
InChIKeyAETNXJMNGGWZCY-UHFFFAOYSA-N
XLogP3.84
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.38
LogP ≤ 53.84
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid?
The IUPAC name of 2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid (CID 174594523) is 2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid.
What is the SMILES notation for 2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid?
The canonical SMILES for 2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid is O=C(O)c1cccc(C(=O)O)c1CC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid?
The InChIKey is AETNXJMNGGWZCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O4/c20-17(21)14-2-1-3-15(18(22)23)16(14)10-19-7-11-4-12(8-19)6-13(5-11)9-19/h1-3,11-13H,4-10H2,(H,20,21)(H,22,23).
What are the key properties of 2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid?
2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid has a molecular weight of 314.38 g/mol, XLogP of 3.84, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantylmethyl)benzene-1,3-dicarboxylic acid is sourced from PubChem (CID 174594523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).