C22H25N3O4S — CID 90933555
O-[[3-(3-methoxyphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-(3-methoxyphenyl)carbamothioate (PubChem CID 90933555) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is O-[[3-(3-methoxyphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-(3-methoxyphenyl)carbamothioate.
| Compound Name | O-[[3-(3-methoxyphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-(3-methoxyphenyl)carbamothioate |
|---|---|
| PubChem CID | 90933555 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | O-[[3-(3-methoxyphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-(3-methoxyphenyl)carbamothioate |
| SMILES | COc1cccc(NC(=S)ON2CCC3(C=C(c4cccc(OC)c4)NO3)CC2)c1 |
| InChI | InChI=1S/C22H25N3O4S/c1-26-18-7-3-5-16(13-18)20-15-22(29-24-20)9-11-25(12-10-22)28-21(30)23-17-6-4-8-19(14-17)27-2/h3-8,13-15,24H,9-12H2,1-2H3,(H,23,30) |
| InChIKey | SPHXUBYSRMLFGT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|