C29H34N2O3 — CID 91343337
3-tert-butyl-1-[3-(3-methoxyphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]-5-phenylpenta-2,4-dien-1-one (PubChem CID 91343337) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is 3-tert-butyl-1-[3-(3-methoxyphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]-5-phenylpenta-2,4-dien-1-one.
| Compound Name | 3-tert-butyl-1-[3-(3-methoxyphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]-5-phenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 91343337 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 3-tert-butyl-1-[3-(3-methoxyphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]-5-phenylpenta-2,4-dien-1-one |
| SMILES | COc1cccc(C2=CC3(CCN(C(=O)C=C(C=Cc4ccccc4)C(C)(C)C)CC3)ON2)c1 |
| InChI | InChI=1S/C29H34N2O3/c1-28(2,3)24(14-13-22-9-6-5-7-10-22)20-27(32)31-17-15-29(16-18-31)21-26(30-34-29)23-11-8-12-25(19-23)33-4/h5-14,19-21,30H,15-18H2,1-4H3 |
| InChIKey | BDISITPONSLHSW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|