C16H18N2O8 — CID 90934230
1-[(2R,3R,5R)-3,4,4-trihydroxy-5-(hydroxymethyl)-3-phenylmethoxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 90934230) has the molecular formula C16H18N2O8 and a molecular weight of 366.33 g/mol. Its IUPAC name is 1-[(2R,3R,5R)-3,4,4-trihydroxy-5-(hydroxymethyl)-3-phenylmethoxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,5R)-3,4,4-trihydroxy-5-(hydroxymethyl)-3-phenylmethoxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90934230 |
| Molecular Formula | C16H18N2O8 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-[(2R,3R,5R)-3,4,4-trihydroxy-5-(hydroxymethyl)-3-phenylmethoxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)C(O)(O)[C@]2(O)OCc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H18N2O8/c19-8-11-15(22,23)16(24,25-9-10-4-2-1-3-5-10)13(26-11)18-7-6-12(20)17-14(18)21/h1-7,11,13,19,22-24H,8-9H2,(H,17,20,21)/t11-,13-,16-/m1/s1 |
| InChIKey | GKSHOKYOVQFCFS-AXAPSJFSSA-N |
| XLogP | -1.99 |
| TPSA | 154.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|