C14H19FN2O7 — CID 150547436
[(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-2-(hydroxymethyl)-4-methyloxolan-3-yl] butanoate (PubChem CID 150547436) has the molecular formula C14H19FN2O7 and a molecular weight of 346.31 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-2-(hydroxymethyl)-4-methyloxolan-3-yl] butanoate.
| Compound Name | [(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-2-(hydroxymethyl)-4-methyloxolan-3-yl] butanoate |
|---|---|
| PubChem CID | 150547436 |
| Molecular Formula | C14H19FN2O7 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-2-(hydroxymethyl)-4-methyloxolan-3-yl] butanoate |
| SMILES | CCCC(=O)O[C@@]1(O)[C@@H](CO)O[C@@H](n2ccc(=O)[nH]c2=O)[C@]1(C)F |
| InChI | InChI=1S/C14H19FN2O7/c1-3-4-10(20)24-14(22)8(7-18)23-11(13(14,2)15)17-6-5-9(19)16-12(17)21/h5-6,8,11,18,22H,3-4,7H2,1-2H3,(H,16,19,21)/t8-,11-,13+,14+/m1/s1 |
| InChIKey | IHDTYOMSLFIXBN-BLJJELEKSA-N |
| XLogP | -0.81 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|