C23H31ClN4O2S — CID 90935306
N-[(4-chlorophenyl)methyl]-8-[cyclohexyl(methyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide (PubChem CID 90935306) has the molecular formula C23H31ClN4O2S and a molecular weight of 463.05 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-8-[cyclohexyl(methyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-8-[cyclohexyl(methyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 90935306 |
| Molecular Formula | C23H31ClN4O2S |
| Molecular Weight | 463.05 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-8-[cyclohexyl(methyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide |
| SMILES | CN(C(=S)N1CCC2(C=C(C(=O)NCc3ccc(Cl)cc3)NO2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C23H31ClN4O2S/c1-27(19-5-3-2-4-6-19)22(31)28-13-11-23(12-14-28)15-20(26-30-23)21(29)25-16-17-7-9-18(24)10-8-17/h7-10,15,19,26H,2-6,11-14,16H2,1H3,(H,25,29) |
| InChIKey | HRNYSZFGDVDKIV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.05 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|