About 3-imino-1,6-dimethyl-2H-pyridin-6-amine
3-imino-1,6-dimethyl-2H-pyridin-6-amine (PubChem CID 90936602) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is 3-imino-1,6-dimethyl-2H-pyridin-6-amine.
Molecular Properties
| Compound Name | 3-imino-1,6-dimethyl-2H-pyridin-6-amine |
| PubChem CID | 90936602 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 3-imino-1,6-dimethyl-2H-pyridin-6-amine |
| SMILES | [H]/N=C1\C=CC(C)(N)N(C)C1 |
| InChI | InChI=1S/C7H13N3/c1-7(9)4-3-6(8)5-10(7)2/h3-4,8H,5,9H2,1-2H3/b8-6+ |
| InChIKey | XALCCOYTQJEKCB-SOFGYWHQSA-N |
| XLogP | 0.18 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-1,6-dimethyl-2H-pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-1,6-dimethyl-2H-pyridin-6-amine?
The IUPAC name of 3-imino-1,6-dimethyl-2H-pyridin-6-amine (CID 90936602) is 3-imino-1,6-dimethyl-2H-pyridin-6-amine.
What is the SMILES notation for 3-imino-1,6-dimethyl-2H-pyridin-6-amine?
The canonical SMILES for 3-imino-1,6-dimethyl-2H-pyridin-6-amine is [H]/N=C1\C=CC(C)(N)N(C)C1.
What is the InChIKey of 3-imino-1,6-dimethyl-2H-pyridin-6-amine?
The InChIKey is XALCCOYTQJEKCB-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H13N3/c1-7(9)4-3-6(8)5-10(7)2/h3-4,8H,5,9H2,1-2H3/b8-6+.
What are the key properties of 3-imino-1,6-dimethyl-2H-pyridin-6-amine?
3-imino-1,6-dimethyl-2H-pyridin-6-amine has a molecular weight of 139.20 g/mol, XLogP of 0.18, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-1,6-dimethyl-2H-pyridin-6-amine is sourced from PubChem (CID 90936602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).