C6H10N2 — CID 123316768
1-methyl-2,6-dihydropyridin-3-imine (PubChem CID 123316768) has the molecular formula C6H10N2 and a molecular weight of 110.16 g/mol. Its IUPAC name is 1-methyl-2,6-dihydropyridin-3-imine.
| Compound Name | 1-methyl-2,6-dihydropyridin-3-imine |
|---|---|
| PubChem CID | 123316768 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 1-methyl-2,6-dihydropyridin-3-imine |
| SMILES | [H]/N=C1\C=CCN(C)C1 |
| InChI | InChI=1S/C6H10N2/c1-8-4-2-3-6(7)5-8/h2-3,7H,4-5H2,1H3/b7-6+ |
| InChIKey | VIAWGHKBRIKSGG-VOTSOKGWSA-N |
| XLogP | 0.51 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|