C9H13N2+ — CID 91473359
ethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)-methylazanium (PubChem CID 91473359) has the molecular formula C9H13N2+ and a molecular weight of 149.22 g/mol. Its IUPAC name is ethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)-methylazanium.
| Compound Name | ethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)-methylazanium |
|---|---|
| PubChem CID | 91473359 |
| Molecular Formula | C9H13N2+ |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.11 |
| IUPAC Name | ethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)-methylazanium |
| SMILES | [H]N=C1C=CC(=[N+](C)CC)C=C1 |
| InChI | InChI=1S/C9H13N2/c1-3-11(2)9-6-4-8(10)5-7-9/h4-7,10H,3H2,1-2H3/q+1/b10-8-,11-9+ |
| InChIKey | VKWMXEFJYDGWMG-PNQPDEHRSA-N |
| XLogP | 1.24 |
| TPSA | 26.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|