C9H17N3 — CID 123382111
2-(3-imino-2,6-dihydropyridin-1-yl)-N,N-dimethylethanamine (PubChem CID 123382111) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 2-(3-imino-2,6-dihydropyridin-1-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(3-imino-2,6-dihydropyridin-1-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 123382111 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 2-(3-imino-2,6-dihydropyridin-1-yl)-N,N-dimethylethanamine |
| SMILES | [H]/N=C1\C=CCN(CCN(C)C)C1 |
| InChI | InChI=1S/C9H17N3/c1-11(2)6-7-12-5-3-4-9(10)8-12/h3-4,10H,5-8H2,1-2H3/b10-9+ |
| InChIKey | QVAALKVEGMEPAP-MDZDMXLPSA-N |
| XLogP | 0.44 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|