C12H21N3 — CID 123359389
(4Z)-6-(4-methylpiperazin-1-yl)hepta-1,4-dien-3-imine (PubChem CID 123359389) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is (4Z)-6-(4-methylpiperazin-1-yl)hepta-1,4-dien-3-imine.
| Compound Name | (4Z)-6-(4-methylpiperazin-1-yl)hepta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 123359389 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (4Z)-6-(4-methylpiperazin-1-yl)hepta-1,4-dien-3-imine |
| SMILES | [H]/N=C(C=C)/C=C\C(C)N1CCN(C)CC1 |
| InChI | InChI=1S/C12H21N3/c1-4-12(13)6-5-11(2)15-9-7-14(3)8-10-15/h4-6,11,13H,1,7-10H2,2-3H3/b6-5-,13-12+ |
| InChIKey | CYCNPAZWHDEMJF-RCXQYVMGSA-N |
| XLogP | 1.38 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|