C14H25N3 — CID 123942337
1-[(2Z,5Z)-4-iminohepta-2,5-dienyl]-N,N-dimethylpiperidin-4-amine (PubChem CID 123942337) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is 1-[(2Z,5Z)-4-iminohepta-2,5-dienyl]-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-[(2Z,5Z)-4-iminohepta-2,5-dienyl]-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 123942337 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 1-[(2Z,5Z)-4-iminohepta-2,5-dienyl]-N,N-dimethylpiperidin-4-amine |
| SMILES | [H]/N=C(\C=C/C)/C=C\CN1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C14H25N3/c1-4-6-13(15)7-5-10-17-11-8-14(9-12-17)16(2)3/h4-7,14-15H,8-12H2,1-3H3/b6-4-,7-5-,15-13+ |
| InChIKey | OJUCSBPTWGSQGD-OUESDXOXSA-N |
| XLogP | 2.16 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|