C14H24N4 — CID 91418414
1-(4,5-diiminocyclohept-2-en-1-yl)-N,N-dimethylpiperidin-4-amine (PubChem CID 91418414) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-(4,5-diiminocyclohept-2-en-1-yl)-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-(4,5-diiminocyclohept-2-en-1-yl)-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 91418414 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 1-(4,5-diiminocyclohept-2-en-1-yl)-N,N-dimethylpiperidin-4-amine |
| SMILES | [H]/N=C1\C=CC(N2CCC(N(C)C)CC2)CC\C1=N/[H] |
| InChI | InChI=1S/C14H24N4/c1-17(2)11-7-9-18(10-8-11)12-3-5-13(15)14(16)6-4-12/h3,5,11-12,15-16H,4,6-10H2,1-2H3/b15-13+,16-14+ |
| InChIKey | CRSNUAZFOIEURQ-WXUKJITCSA-N |
| XLogP | 1.77 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|