C15H27N3 — CID 123871350
1-[(5Z)-7-iminoocta-3,5-dien-4-yl]-N,N-dimethylpiperidin-4-amine (PubChem CID 123871350) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 1-[(5Z)-7-iminoocta-3,5-dien-4-yl]-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-[(5Z)-7-iminoocta-3,5-dien-4-yl]-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 123871350 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 1-[(5Z)-7-iminoocta-3,5-dien-4-yl]-N,N-dimethylpiperidin-4-amine |
| SMILES | [H]/N=C(C)\C=C/C(=CCC)N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C15H27N3/c1-5-6-15(8-7-13(2)16)18-11-9-14(10-12-18)17(3)4/h6-8,14,16H,5,9-12H2,1-4H3/b8-7-,15-6?,16-13- |
| InChIKey | QKQQWIFEUSLUMD-FIXGTDDGSA-N |
| XLogP | 2.90 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|