C12H22N2 — CID 142872816
1-[(2Z,4E)-hepta-2,4-dien-4-yl]piperidin-4-amine (PubChem CID 142872816) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-[(2Z,4E)-hepta-2,4-dien-4-yl]piperidin-4-amine.
| Compound Name | 1-[(2Z,4E)-hepta-2,4-dien-4-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 142872816 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-[(2Z,4E)-hepta-2,4-dien-4-yl]piperidin-4-amine |
| SMILES | C/C=C\C(=C/CC)N1CCC(N)CC1 |
| InChI | InChI=1S/C12H22N2/c1-3-5-12(6-4-2)14-9-7-11(13)8-10-14/h3,5-6,11H,4,7-10,13H2,1-2H3/b5-3-,12-6+ |
| InChIKey | HSOIVSHDESFTSN-YXMBOXQASA-N |
| XLogP | 2.28 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|