C11H16BrFN2 — CID 162526561
6-bromo-1-(3-fluoropiperidin-4-yl)-2-methyl-2H-pyridine (PubChem CID 162526561) has the molecular formula C11H16BrFN2 and a molecular weight of 275.16 g/mol. Its IUPAC name is 6-bromo-1-(3-fluoropiperidin-4-yl)-2-methyl-2H-pyridine.
| Compound Name | 6-bromo-1-(3-fluoropiperidin-4-yl)-2-methyl-2H-pyridine |
|---|---|
| PubChem CID | 162526561 |
| Molecular Formula | C11H16BrFN2 |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 6-bromo-1-(3-fluoropiperidin-4-yl)-2-methyl-2H-pyridine |
| SMILES | CC1C=CC=C(Br)N1C1CCNCC1F |
| InChI | InChI=1S/C11H16BrFN2/c1-8-3-2-4-11(12)15(8)10-5-6-14-7-9(10)13/h2-4,8-10,14H,5-7H2,1H3 |
| InChIKey | ZPFQDVCVYVDURI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|