C15H30N4 — CID 123947681
N,N-diethyl-2-[4-[(E)-4-iminopent-2-en-2-yl]piperazin-1-yl]ethanamine (PubChem CID 123947681) has the molecular formula C15H30N4 and a molecular weight of 266.43 g/mol. Its IUPAC name is N,N-diethyl-2-[4-[(E)-4-iminopent-2-en-2-yl]piperazin-1-yl]ethanamine.
| Compound Name | N,N-diethyl-2-[4-[(E)-4-iminopent-2-en-2-yl]piperazin-1-yl]ethanamine |
|---|---|
| PubChem CID | 123947681 |
| Molecular Formula | C15H30N4 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.25 |
| IUPAC Name | N,N-diethyl-2-[4-[(E)-4-iminopent-2-en-2-yl]piperazin-1-yl]ethanamine |
| SMILES | [H]/N=C(C)/C=C(\C)N1CCN(CCN(CC)CC)CC1 |
| InChI | InChI=1S/C15H30N4/c1-5-17(6-2)7-8-18-9-11-19(12-10-18)15(4)13-14(3)16/h13,16H,5-12H2,1-4H3/b15-13+,16-14+ |
| InChIKey | AXGWKBKADMDBDJ-WXUKJITCSA-N |
| XLogP | 1.89 |
| TPSA | 33.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|