C12H20FN3 — CID 123842165
(E)-4-fluoro-N-[(Z)-1-piperazin-1-ylprop-1-en-2-yl]pent-3-en-2-imine (PubChem CID 123842165) has the molecular formula C12H20FN3 and a molecular weight of 225.31 g/mol. Its IUPAC name is (E)-4-fluoro-N-[(Z)-1-piperazin-1-ylprop-1-en-2-yl]pent-3-en-2-imine.
| Compound Name | (E)-4-fluoro-N-[(Z)-1-piperazin-1-ylprop-1-en-2-yl]pent-3-en-2-imine |
|---|---|
| PubChem CID | 123842165 |
| Molecular Formula | C12H20FN3 |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | (E)-4-fluoro-N-[(Z)-1-piperazin-1-ylprop-1-en-2-yl]pent-3-en-2-imine |
| SMILES | CC(=C/N1CCNCC1)/N=C(C)/C=C(\C)F |
| InChI | InChI=1S/C12H20FN3/c1-10(13)8-11(2)15-12(3)9-16-6-4-14-5-7-16/h8-9,14H,4-7H2,1-3H3/b10-8+,12-9-,15-11+ |
| InChIKey | XFQJVKQQWDCSEA-RTXVZISQSA-N |
| XLogP | 2.09 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|