C8H14N2 — CID 123316650
1,2-dimethyl-3,7-dihydro-2H-azepin-6-imine (PubChem CID 123316650) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 1,2-dimethyl-3,7-dihydro-2H-azepin-6-imine.
| Compound Name | 1,2-dimethyl-3,7-dihydro-2H-azepin-6-imine |
|---|---|
| PubChem CID | 123316650 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 1,2-dimethyl-3,7-dihydro-2H-azepin-6-imine |
| SMILES | [H]/N=C1\C=CCC(C)N(C)C1 |
| InChI | InChI=1S/C8H14N2/c1-7-4-3-5-8(9)6-10(7)2/h3,5,7,9H,4,6H2,1-2H3/b9-8+ |
| InChIKey | CIEQOIKXRGJOSB-CMDGGOBGSA-N |
| XLogP | 1.29 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|