C7H14N2 — CID 123865844
2-imino-N,N-dimethylpent-3-en-1-amine (PubChem CID 123865844) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 2-imino-N,N-dimethylpent-3-en-1-amine.
| Compound Name | 2-imino-N,N-dimethylpent-3-en-1-amine |
|---|---|
| PubChem CID | 123865844 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 2-imino-N,N-dimethylpent-3-en-1-amine |
| SMILES | [H]/N=C(\C=CC)CN(C)C |
| InChI | InChI=1S/C7H14N2/c1-4-5-7(8)6-9(2)3/h4-5,8H,6H2,1-3H3/b5-4?,8-7+ |
| InChIKey | ZRPREUXTSSBRJA-HEFSFIJHSA-N |
| XLogP | 1.14 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|