About CID 90938884
CID 90938884 (PubChem CID 90938884) has the molecular formula C19H24N2O4
and a molecular weight of 344.41 g/mol.
Molecular Properties
| Compound Name | CID 90938884 |
| PubChem CID | 90938884 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | — |
| SMILES | CCc1ccc2c(c1)C1(NC(=O)N(C)C1=O)C1(CCC(OC)CC1)O2 |
| InChI | InChI=1S/C19H24N2O4/c1-4-12-5-6-15-14(11-12)19(16(22)21(2)17(23)20-19)18(25-15)9-7-13(24-3)8-10-18/h5-6,11,13H,4,7-10H2,1-3H3,(H,20,23) |
| InChIKey | ZLGOEHCAQYRNQK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze CID 90938884 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90938884?
The IUPAC name of CID 90938884 (CID 90938884) is not available.
What is the SMILES notation for CID 90938884?
The canonical SMILES for CID 90938884 is CCc1ccc2c(c1)C1(NC(=O)N(C)C1=O)C1(CCC(OC)CC1)O2.
What is the InChIKey of CID 90938884?
The InChIKey is ZLGOEHCAQYRNQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O4/c1-4-12-5-6-15-14(11-12)19(16(22)21(2)17(23)20-19)18(25-15)9-7-13(24-3)8-10-18/h5-6,11,13H,4,7-10H2,1-3H3,(H,20,23).
What are the key properties of CID 90938884?
CID 90938884 has a molecular weight of 344.41 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90938884 is sourced from PubChem (CID 90938884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).