C22H23FN5O3+ — CID 90938906
5-[(2R)-1-carbamoyl-2-methylpyrrolidin-1-ium-1-yl]-N-[(4-fluorophenyl)methyl]-8-hydroxy-1,6-naphthyridine-7-carboxamide (PubChem CID 90938906) has the molecular formula C22H23FN5O3+ and a molecular weight of 424.46 g/mol. Its IUPAC name is 5-[(2R)-1-carbamoyl-2-methylpyrrolidin-1-ium-1-yl]-N-[(4-fluorophenyl)methyl]-8-hydroxy-1,6-naphthyridine-7-carboxamide.
| Compound Name | 5-[(2R)-1-carbamoyl-2-methylpyrrolidin-1-ium-1-yl]-N-[(4-fluorophenyl)methyl]-8-hydroxy-1,6-naphthyridine-7-carboxamide |
|---|---|
| PubChem CID | 90938906 |
| Molecular Formula | C22H23FN5O3+ |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 5-[(2R)-1-carbamoyl-2-methylpyrrolidin-1-ium-1-yl]-N-[(4-fluorophenyl)methyl]-8-hydroxy-1,6-naphthyridine-7-carboxamide |
| SMILES | C[C@@H]1CCC[N+]1(C(N)=O)c1nc(C(=O)NCc2ccc(F)cc2)c(O)c2ncccc12 |
| InChI | InChI=1S/C22H22FN5O3/c1-13-4-3-11-28(13,22(24)31)20-16-5-2-10-25-17(16)19(29)18(27-20)21(30)26-12-14-6-8-15(23)9-7-14/h2,5-10,13H,3-4,11-12H2,1H3,(H3-,24,26,29,30,31)/p+1/t13-,28?/m1/s1 |
| InChIKey | HNAILYHMRBUGCL-OGMHVPHJSA-O |
| XLogP | 2.97 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|