C12H14N2 — CID 90940119
2,3,3a,4,5,10a-hexahydropyrrolo[2,3-g][3]benzazepine (PubChem CID 90940119) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 2,3,3a,4,5,10a-hexahydropyrrolo[2,3-g][3]benzazepine.
| Compound Name | 2,3,3a,4,5,10a-hexahydropyrrolo[2,3-g][3]benzazepine |
|---|---|
| PubChem CID | 90940119 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2,3,3a,4,5,10a-hexahydropyrrolo[2,3-g][3]benzazepine |
| SMILES | C1=CC2C(=CC=N1)CCC1CCN=C12 |
| InChI | InChI=1S/C12H14N2/c1-2-10-4-8-14-12(10)11-5-7-13-6-3-9(1)11/h3,5-7,10-11H,1-2,4,8H2 |
| InChIKey | XBAKLLJVJFVIGI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |