C11H13N3 — CID 91112582
3,3a,4,4a,10,10a-hexahydropyrazolo[4,3-h][3]benzazepine (PubChem CID 91112582) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 3,3a,4,4a,10,10a-hexahydropyrazolo[4,3-h][3]benzazepine.
| Compound Name | 3,3a,4,4a,10,10a-hexahydropyrazolo[4,3-h][3]benzazepine |
|---|---|
| PubChem CID | 91112582 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 3,3a,4,4a,10,10a-hexahydropyrazolo[4,3-h][3]benzazepine |
| SMILES | C1=CC2CC3CN=NC3CC2=CC=N1 |
| InChI | InChI=1S/C11H13N3/c1-3-12-4-2-9-6-11-10(5-8(1)9)7-13-14-11/h1-4,8,10-11H,5-7H2 |
| InChIKey | FQIIHMNDRJQNGA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |