C26H26F3N3O8 — CID 90940316
2-[1-(1,3-benzodioxol-5-yl)-2-[3-[2-[5-(methoxymethyl)-6-(methylamino)-2-pyridinyl]ethoxy]-1,2-oxazol-5-yl]ethyl]-4,4,4-trifluoro-3-oxobutanoic acid (PubChem CID 90940316) has the molecular formula C26H26F3N3O8 and a molecular weight of 565.50 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-yl)-2-[3-[2-[5-(methoxymethyl)-6-(methylamino)-2-pyridinyl]ethoxy]-1,2-oxazol-5-yl]ethyl]-4,4,4-trifluoro-3-oxobutanoic acid.
| Compound Name | 2-[1-(1,3-benzodioxol-5-yl)-2-[3-[2-[5-(methoxymethyl)-6-(methylamino)-2-pyridinyl]ethoxy]-1,2-oxazol-5-yl]ethyl]-4,4,4-trifluoro-3-oxobutanoic acid |
|---|---|
| PubChem CID | 90940316 |
| Molecular Formula | C26H26F3N3O8 |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-5-yl)-2-[3-[2-[5-(methoxymethyl)-6-(methylamino)-2-pyridinyl]ethoxy]-1,2-oxazol-5-yl]ethyl]-4,4,4-trifluoro-3-oxobutanoic acid |
| SMILES | CNc1nc(CCOc2cc(CC(c3ccc4c(c3)OCO4)C(C(=O)O)C(=O)C(F)(F)F)on2)ccc1COC |
| InChI | InChI=1S/C26H26F3N3O8/c1-30-24-15(12-36-2)3-5-16(31-24)7-8-37-21-11-17(40-32-21)10-18(22(25(34)35)23(33)26(27,28)29)14-4-6-19-20(9-14)39-13-38-19/h3-6,9,11,18,22H,7-8,10,12-13H2,1-2H3,(H,30,31)(H,34,35) |
| InChIKey | VXPMGBUCGUSPQP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|