C26H24F3N3O8 — CID 91041421
2-[1-(1,3-benzodioxol-5-yl)-2-[3-[2-(1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepin-8-yl)ethoxy]-1,2-oxazol-5-yl]ethyl]-4,4,4-trifluoro-3-oxobutanoic acid (PubChem CID 91041421) has the molecular formula C26H24F3N3O8 and a molecular weight of 563.49 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-yl)-2-[3-[2-(1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepin-8-yl)ethoxy]-1,2-oxazol-5-yl]ethyl]-4,4,4-trifluoro-3-oxobutanoic acid.
| Compound Name | 2-[1-(1,3-benzodioxol-5-yl)-2-[3-[2-(1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepin-8-yl)ethoxy]-1,2-oxazol-5-yl]ethyl]-4,4,4-trifluoro-3-oxobutanoic acid |
|---|---|
| PubChem CID | 91041421 |
| Molecular Formula | C26H24F3N3O8 |
| Molecular Weight | 563.49 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-5-yl)-2-[3-[2-(1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepin-8-yl)ethoxy]-1,2-oxazol-5-yl]ethyl]-4,4,4-trifluoro-3-oxobutanoic acid |
| SMILES | O=C(O)C(C(=O)C(F)(F)F)C(Cc1cc(OCCc2ccc3c(n2)NCCOC3)no1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H24F3N3O8/c27-26(28,29)23(33)22(25(34)35)18(14-2-4-19-20(9-14)39-13-38-19)10-17-11-21(32-40-17)37-7-5-16-3-1-15-12-36-8-6-30-24(15)31-16/h1-4,9,11,18,22H,5-8,10,12-13H2,(H,30,31)(H,34,35) |
| InChIKey | FLELWDRNZJGLJN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|