C30H23N5 — CID 90940883
6-[diphenyl-(3-phenylphenyl)methyl]-1H-pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 90940883) has the molecular formula C30H23N5 and a molecular weight of 453.55 g/mol. Its IUPAC name is 6-[diphenyl-(3-phenylphenyl)methyl]-1H-pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-[diphenyl-(3-phenylphenyl)methyl]-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 90940883 |
| Molecular Formula | C30H23N5 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 6-[diphenyl-(3-phenylphenyl)methyl]-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1nc(C(c2ccccc2)(c2ccccc2)c2cccc(-c3ccccc3)c2)nc2[nH]ncc12 |
| InChI | InChI=1S/C30H23N5/c31-27-26-20-32-35-28(26)34-29(33-27)30(23-14-6-2-7-15-23,24-16-8-3-9-17-24)25-18-10-13-22(19-25)21-11-4-1-5-12-21/h1-20H,(H3,31,32,33,34,35) |
| InChIKey | JOYZPFYBVYKEMQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|