C14H14F3NO4 — CID 90943880
methyl 5,5,5-trifluoro-2-phenylmethoxycarbonyliminopentanoate (PubChem CID 90943880) has the molecular formula C14H14F3NO4 and a molecular weight of 317.26 g/mol. Its IUPAC name is methyl 5,5,5-trifluoro-2-phenylmethoxycarbonyliminopentanoate.
| Compound Name | methyl 5,5,5-trifluoro-2-phenylmethoxycarbonyliminopentanoate |
|---|---|
| PubChem CID | 90943880 |
| Molecular Formula | C14H14F3NO4 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | methyl 5,5,5-trifluoro-2-phenylmethoxycarbonyliminopentanoate |
| SMILES | COC(=O)C(CCC(F)(F)F)=NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H14F3NO4/c1-21-12(19)11(7-8-14(15,16)17)18-13(20)22-9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3 |
| InChIKey | VDEUPRAHPPOFDA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|