C20H24ClN3O2S — CID 90944160
N-[2-(2-chloro-4-methylanilino)-1,5-dimethyl-6-oxo-3-pyridinyl]-1-prop-2-enylcyclopropane-1-sulfinamide (PubChem CID 90944160) has the molecular formula C20H24ClN3O2S and a molecular weight of 405.95 g/mol. Its IUPAC name is N-[2-(2-chloro-4-methylanilino)-1,5-dimethyl-6-oxo-3-pyridinyl]-1-prop-2-enylcyclopropane-1-sulfinamide.
| Compound Name | N-[2-(2-chloro-4-methylanilino)-1,5-dimethyl-6-oxo-3-pyridinyl]-1-prop-2-enylcyclopropane-1-sulfinamide |
|---|---|
| PubChem CID | 90944160 |
| Molecular Formula | C20H24ClN3O2S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[2-(2-chloro-4-methylanilino)-1,5-dimethyl-6-oxo-3-pyridinyl]-1-prop-2-enylcyclopropane-1-sulfinamide |
| SMILES | C=CCC1(S(=O)Nc2cc(C)c(=O)n(C)c2Nc2ccc(C)cc2Cl)CC1 |
| InChI | InChI=1S/C20H24ClN3O2S/c1-5-8-20(9-10-20)27(26)23-17-12-14(3)19(25)24(4)18(17)22-16-7-6-13(2)11-15(16)21/h5-7,11-12,22-23H,1,8-10H2,2-4H3 |
| InChIKey | KJKFUBMGCHUBQX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|