C17H21Cl2N3O2S — CID 91072184
3-chloro-N-[2-(2-chloro-4-methylanilino)-1,5-dimethyl-6-oxo-3-pyridinyl]propane-1-sulfinamide (PubChem CID 91072184) has the molecular formula C17H21Cl2N3O2S and a molecular weight of 402.35 g/mol. Its IUPAC name is 3-chloro-N-[2-(2-chloro-4-methylanilino)-1,5-dimethyl-6-oxo-3-pyridinyl]propane-1-sulfinamide.
| Compound Name | 3-chloro-N-[2-(2-chloro-4-methylanilino)-1,5-dimethyl-6-oxo-3-pyridinyl]propane-1-sulfinamide |
|---|---|
| PubChem CID | 91072184 |
| Molecular Formula | C17H21Cl2N3O2S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 3-chloro-N-[2-(2-chloro-4-methylanilino)-1,5-dimethyl-6-oxo-3-pyridinyl]propane-1-sulfinamide |
| SMILES | Cc1ccc(Nc2c(NS(=O)CCCCl)cc(C)c(=O)n2C)c(Cl)c1 |
| InChI | InChI=1S/C17H21Cl2N3O2S/c1-11-5-6-14(13(19)9-11)20-16-15(21-25(24)8-4-7-18)10-12(2)17(23)22(16)3/h5-6,9-10,20-21H,4,7-8H2,1-3H3 |
| InChIKey | UUCKQQPUTSKAHK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|