About 3,4-dihydroxy-1-methyl-5-(2-methyl-4-phenylbutanoyl)oxycyclohexane-1-carboxylic acid;ethane
3,4-dihydroxy-1-methyl-5-(2-methyl-4-phenylbutanoyl)oxycyclohexane-1-carboxylic acid;ethane (PubChem CID 90945064) has the molecular formula C21H32O6
and a molecular weight of 380.48 g/mol. Its IUPAC name is 3,4-dihydroxy-1-methyl-5-(2-methyl-4-phenylbutanoyl)oxycyclohexane-1-carboxylic acid;ethane.
Molecular Properties
| Compound Name | 3,4-dihydroxy-1-methyl-5-(2-methyl-4-phenylbutanoyl)oxycyclohexane-1-carboxylic acid;ethane |
| PubChem CID | 90945064 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 3,4-dihydroxy-1-methyl-5-(2-methyl-4-phenylbutanoyl)oxycyclohexane-1-carboxylic acid;ethane |
| SMILES | CC.CC(CCc1ccccc1)C(=O)OC1CC(C)(C(=O)O)CC(O)C1O |
| InChI | InChI=1S/C19H26O6.C2H6/c1-12(8-9-13-6-4-3-5-7-13)17(22)25-15-11-19(2,18(23)24)10-14(20)16(15)21;1-2/h3-7,12,14-16,20-21H,8-11H2,1-2H3,(H,23,24);1-2H3 |
| InChIKey | VLDDKLTXYWYSFR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,4-dihydroxy-1-methyl-5-(2-methyl-4-phenylbutanoyl)oxycyclohexane-1-carboxylic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydroxy-1-methyl-5-(2-methyl-4-phenylbutanoyl)oxycyclohexane-1-carboxylic acid;ethane?
The IUPAC name of 3,4-dihydroxy-1-methyl-5-(2-methyl-4-phenylbutanoyl)oxycyclohexane-1-carboxylic acid;ethane (CID 90945064) is 3,4-dihydroxy-1-methyl-5-(2-methyl-4-phenylbutanoyl)oxycyclohexane-1-carboxylic acid;ethane.
What is the SMILES notation for 3,4-dihydroxy-1-methyl-5-(2-methyl-4-phenylbutanoyl)oxycyclohexane-1-carboxylic acid;ethane?
The canonical SMILES for 3,4-dihydroxy-1-methyl-5-(2-methyl-4-phenylbutanoyl)oxycyclohexane-1-carboxylic acid;ethane is CC.CC(CCc1ccccc1)C(=O)OC1CC(C)(C(=O)O)CC(O)C1O.
What is the InChIKey of 3,4-dihydroxy-1-methyl-5-(2-methyl-4-phenylbutanoyl)oxycyclohexane-1-carboxylic acid;ethane?
The InChIKey is VLDDKLTXYWYSFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O6.C2H6/c1-12(8-9-13-6-4-3-5-7-13)17(22)25-15-11-19(2,18(23)24)10-14(20)16(15)21;1-2/h3-7,12,14-16,20-21H,8-11H2,1-2H3,(H,23,24);1-2H3.
What are the key properties of 3,4-dihydroxy-1-methyl-5-(2-methyl-4-phenylbutanoyl)oxycyclohexane-1-carboxylic acid;ethane?
3,4-dihydroxy-1-methyl-5-(2-methyl-4-phenylbutanoyl)oxycyclohexane-1-carboxylic acid;ethane has a molecular weight of 380.48 g/mol, XLogP of 2.80, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxy-1-methyl-5-(2-methyl-4-phenylbutanoyl)oxycyclohexane-1-carboxylic acid;ethane is sourced from PubChem (CID 90945064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).