C21H26O5 — CID 90945172
2-methylpropyl 4-[[2-(1,2-dihydroxypropoxy)phenyl]methyl]benzoate (PubChem CID 90945172) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is 2-methylpropyl 4-[[2-(1,2-dihydroxypropoxy)phenyl]methyl]benzoate.
| Compound Name | 2-methylpropyl 4-[[2-(1,2-dihydroxypropoxy)phenyl]methyl]benzoate |
|---|---|
| PubChem CID | 90945172 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 2-methylpropyl 4-[[2-(1,2-dihydroxypropoxy)phenyl]methyl]benzoate |
| SMILES | CC(C)COC(=O)c1ccc(Cc2ccccc2OC(O)C(C)O)cc1 |
| InChI | InChI=1S/C21H26O5/c1-14(2)13-25-21(24)17-10-8-16(9-11-17)12-18-6-4-5-7-19(18)26-20(23)15(3)22/h4-11,14-15,20,22-23H,12-13H2,1-3H3 |
| InChIKey | LHWIZSCFQCTRGM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|